C35H32I2N2 — CID 170234395
20,24-bis(2,2-dimethylpropyl)-9,10-diiodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene (PubChem CID 170234395) has the molecular formula C35H32I2N2 and a molecular weight of 734.46 g/mol. Its IUPAC name is 20,24-bis(2,2-dimethylpropyl)-9,10-diiodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene.
| Compound Name | 20,24-bis(2,2-dimethylpropyl)-9,10-diiodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 170234395 |
| Molecular Formula | C35H32I2N2 |
| Molecular Weight | 734.46 g/mol |
| Exact Mass | 734.07 |
| IUPAC Name | 20,24-bis(2,2-dimethylpropyl)-9,10-diiodo-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
| SMILES | CC(C)(C)Cc1ccc2c(CC(C)(C)C)c3c(cc2c1)c1nccc2c(I)c(I)c4c5ccccc5n3c4c21 |
| InChI | InChI=1S/C35H32I2N2/c1-34(2,3)17-19-11-12-21-20(15-19)16-24-31-28-23(13-14-38-31)29(36)30(37)27-22-9-7-8-10-26(22)39(33(27)28)32(24)25(21)18-35(4,5)6/h7-16H,17-18H2,1-6H3 |
| InChIKey | GCKFSELLLHBZMN-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.46 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|