C40H44N2 — CID 170233162
6,20,24-tris(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene (PubChem CID 170233162) has the molecular formula C40H44N2 and a molecular weight of 552.81 g/mol. Its IUPAC name is 6,20,24-tris(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene.
| Compound Name | 6,20,24-tris(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 170233162 |
| Molecular Formula | C40H44N2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 6,20,24-tris(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
| SMILES | CC(C)(C)Cc1ccc2c(CC(C)(C)C)c3c(cc2c1)c1nccc2ccc4c5c(CC(C)(C)C)cccc5n3c4c21 |
| InChI | InChI=1S/C40H44N2/c1-38(2,3)21-24-13-15-28-27(19-24)20-30-35-34-25(17-18-41-35)14-16-29-33-26(22-39(4,5)6)11-10-12-32(33)42(37(29)34)36(30)31(28)23-40(7,8)9/h10-20H,21-23H2,1-9H3 |
| InChIKey | KNQJMLXXQXCIEI-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|