C39H42N2 — CID 170232753
20-tert-butyl-9,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene (PubChem CID 170232753) has the molecular formula C39H42N2 and a molecular weight of 538.78 g/mol. Its IUPAC name is 20-tert-butyl-9,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene.
| Compound Name | 20-tert-butyl-9,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene |
|---|---|
| PubChem CID | 170232753 |
| Molecular Formula | C39H42N2 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | 20-tert-butyl-9,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene |
| SMILES | CC(C)(C)Cc1cc2ccnc3c4cc5cc(C(C)(C)C)ccc5c(CC(C)(C)C)c4n4c5ccccc5c1c4c23 |
| InChI | InChI=1S/C39H42N2/c1-37(2,3)21-25-18-23-16-17-40-34-29-20-24-19-26(39(7,8)9)14-15-27(24)30(22-38(4,5)6)35(29)41-31-13-11-10-12-28(31)32(25)36(41)33(23)34/h10-20H,21-22H2,1-9H3 |
| InChIKey | IODGMFCACONCSU-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|