C35H35N2P — CID 170234278
[20,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaen-10-yl]phosphane (PubChem CID 170234278) has the molecular formula C35H35N2P and a molecular weight of 514.65 g/mol. Its IUPAC name is [20,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaen-10-yl]phosphane.
| Compound Name | [20,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaen-10-yl]phosphane |
|---|---|
| PubChem CID | 170234278 |
| Molecular Formula | C35H35N2P |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [20,24-bis(2,2-dimethylpropyl)-1,14-diazaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaen-10-yl]phosphane |
| SMILES | CC(C)(C)Cc1ccc2c(CC(C)(C)C)c3c(cc2c1)c1nccc2c(P)cc4c5ccccc5n3c4c21 |
| InChI | InChI=1S/C35H35N2P/c1-34(2,3)18-20-11-12-22-21(15-20)16-26-31-30-24(13-14-36-31)29(38)17-25-23-9-7-8-10-28(23)37(33(25)30)32(26)27(22)19-35(4,5)6/h7-17H,18-19,38H2,1-6H3 |
| InChIKey | CPYOWURQMHOVIH-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|