C29H16N4O4 — CID 146510416
methyl 2-(11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18,20,22,24,26(30),27-tridecaen-6-yl)acetate (PubChem CID 146510416) has the molecular formula C29H16N4O4 and a molecular weight of 484.47 g/mol. Its IUPAC name is methyl 2-(11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18,20,22,24,26(30),27-tridecaen-6-yl)acetate.
| Compound Name | methyl 2-(11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18,20,22,24,26(30),27-tridecaen-6-yl)acetate |
|---|---|
| PubChem CID | 146510416 |
| Molecular Formula | C29H16N4O4 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | methyl 2-(11,16-dioxo-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18,20,22,24,26(30),27-tridecaen-6-yl)acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)nc1c3ccc4c5c(ccc(c(=O)n21)c35)c(=O)n1c2ccccc2nc41 |
| InChI | InChI=1S/C29H16N4O4/c1-37-23(34)13-14-6-11-22-20(12-14)31-27-16-8-7-15-24-17(9-10-18(25(16)24)29(36)33(22)27)28(35)32-21-5-3-2-4-19(21)30-26(15)32/h2-12H,13H2,1H3 |
| InChIKey | JLORGHZYXREVOV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 95.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|