C26H14N2O3S — CID 151770588
methyl 11-oxo-22-thia-3,10-diazaheptacyclo[13.10.2.02,10.04,9.012,26.016,21.023,27]heptacosa-1(25),2,4(9),5,7,12(26),13,15(27),16,18,20,23-dodecaene-6-carboxylate (PubChem CID 151770588) has the molecular formula C26H14N2O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is methyl 11-oxo-22-thia-3,10-diazaheptacyclo[13.10.2.02,10.04,9.012,26.016,21.023,27]heptacosa-1(25),2,4(9),5,7,12(26),13,15(27),16,18,20,23-dodecaene-6-carboxylate.
| Compound Name | methyl 11-oxo-22-thia-3,10-diazaheptacyclo[13.10.2.02,10.04,9.012,26.016,21.023,27]heptacosa-1(25),2,4(9),5,7,12(26),13,15(27),16,18,20,23-dodecaene-6-carboxylate |
|---|---|
| PubChem CID | 151770588 |
| Molecular Formula | C26H14N2O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | methyl 11-oxo-22-thia-3,10-diazaheptacyclo[13.10.2.02,10.04,9.012,26.016,21.023,27]heptacosa-1(25),2,4(9),5,7,12(26),13,15(27),16,18,20,23-dodecaene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc1c3ccc4sc5ccccc5c5ccc(c(=O)n21)c3c45 |
| InChI | InChI=1S/C26H14N2O3S/c1-31-26(30)13-6-10-19-18(12-13)27-24-16-9-11-21-23-15(14-4-2-3-5-20(14)32-21)7-8-17(22(16)23)25(29)28(19)24/h2-12H,1H3 |
| InChIKey | RSMQASBJWCZGGC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|