C26H23NO4S — CID 130279709
14-[5-(1-hydroxyprop-2-enoxy)pentyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione (PubChem CID 130279709) has the molecular formula C26H23NO4S and a molecular weight of 445.54 g/mol. Its IUPAC name is 14-[5-(1-hydroxyprop-2-enoxy)pentyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 14-[5-(1-hydroxyprop-2-enoxy)pentyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 130279709 |
| Molecular Formula | C26H23NO4S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 14-[5-(1-hydroxyprop-2-enoxy)pentyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
| SMILES | C=CC(O)OCCCCCn1c(=O)c2ccc3sc4ccccc4c4ccc(c1=O)c2c34 |
| InChI | InChI=1S/C26H23NO4S/c1-2-22(28)31-15-7-3-6-14-27-25(29)18-11-10-17-16-8-4-5-9-20(16)32-21-13-12-19(26(27)30)23(18)24(17)21/h2,4-5,8-13,22,28H,1,3,6-7,14-15H2 |
| InChIKey | CHFLPMIMVPKZDZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|