C28H19NO4S — CID 164906768
4-[4-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-14-yl)phenyl]butanoic acid (PubChem CID 164906768) has the molecular formula C28H19NO4S and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-[4-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-14-yl)phenyl]butanoic acid.
| Compound Name | 4-[4-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-14-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 164906768 |
| Molecular Formula | C28H19NO4S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[4-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-14-yl)phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(-n2c(=O)c3ccc4sc5ccccc5c5ccc(c2=O)c3c45)cc1 |
| InChI | InChI=1S/C28H19NO4S/c30-24(31)7-3-4-16-8-10-17(11-9-16)29-27(32)20-13-12-19-18-5-1-2-6-22(18)34-23-15-14-21(28(29)33)25(20)26(19)23/h1-2,5-6,8-15H,3-4,7H2,(H,30,31) |
| InChIKey | KPEGNFUOWULLCH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|