C24H25NO2 — CID 59214556
4-[4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]butanoic acid (PubChem CID 59214556) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]butanoic acid.
| Compound Name | 4-[4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 59214556 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-[4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(-n2c(-c3ccccc3)cc3c2CCCC3)cc1 |
| InChI | InChI=1S/C24H25NO2/c26-24(27)12-6-7-18-13-15-21(16-14-18)25-22-11-5-4-10-20(22)17-23(25)19-8-2-1-3-9-19/h1-3,8-9,13-17H,4-7,10-12H2,(H,26,27) |
| InChIKey | JLILJFVSUUCQBE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|