C31H39NO2 — CID 143433071
4-[4-[5-cyclohexyl-2-(2,2-dimethylpropyl)-3-phenylpyrrol-1-yl]phenyl]butanoic acid (PubChem CID 143433071) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 4-[4-[5-cyclohexyl-2-(2,2-dimethylpropyl)-3-phenylpyrrol-1-yl]phenyl]butanoic acid.
| Compound Name | 4-[4-[5-cyclohexyl-2-(2,2-dimethylpropyl)-3-phenylpyrrol-1-yl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 143433071 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 4-[4-[5-cyclohexyl-2-(2,2-dimethylpropyl)-3-phenylpyrrol-1-yl]phenyl]butanoic acid |
| SMILES | CC(C)(C)Cc1c(-c2ccccc2)cc(C2CCCCC2)n1-c1ccc(CCCC(=O)O)cc1 |
| InChI | InChI=1S/C31H39NO2/c1-31(2,3)22-29-27(24-12-6-4-7-13-24)21-28(25-14-8-5-9-15-25)32(29)26-19-17-23(18-20-26)11-10-16-30(33)34/h4,6-7,12-13,17-21,25H,5,8-11,14-16,22H2,1-3H3,(H,33,34) |
| InChIKey | LEJSSVIZLAZSMR-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|