C30H31NO2 — CID 24798001
3-[3-[2-(2,2-dimethylpropyl)-3,5-diphenylpyrrol-1-yl]phenyl]propanoic acid (PubChem CID 24798001) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is 3-[3-[2-(2,2-dimethylpropyl)-3,5-diphenylpyrrol-1-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-[2-(2,2-dimethylpropyl)-3,5-diphenylpyrrol-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 24798001 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 3-[3-[2-(2,2-dimethylpropyl)-3,5-diphenylpyrrol-1-yl]phenyl]propanoic acid |
| SMILES | CC(C)(C)Cc1c(-c2ccccc2)cc(-c2ccccc2)n1-c1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C30H31NO2/c1-30(2,3)21-28-26(23-12-6-4-7-13-23)20-27(24-14-8-5-9-15-24)31(28)25-16-10-11-22(19-25)17-18-29(32)33/h4-16,19-20H,17-18,21H2,1-3H3,(H,32,33) |
| InChIKey | GVHWGKPZGSDBED-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|