C28H27NO2 — CID 24797913
3-[3-(3,5-diphenyl-2-propan-2-ylpyrrol-1-yl)phenyl]propanoic acid (PubChem CID 24797913) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[3-(3,5-diphenyl-2-propan-2-ylpyrrol-1-yl)phenyl]propanoic acid.
| Compound Name | 3-[3-(3,5-diphenyl-2-propan-2-ylpyrrol-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 24797913 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-[3-(3,5-diphenyl-2-propan-2-ylpyrrol-1-yl)phenyl]propanoic acid |
| SMILES | CC(C)c1c(-c2ccccc2)cc(-c2ccccc2)n1-c1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C28H27NO2/c1-20(2)28-25(22-11-5-3-6-12-22)19-26(23-13-7-4-8-14-23)29(28)24-15-9-10-21(18-24)16-17-27(30)31/h3-15,18-20H,16-17H2,1-2H3,(H,30,31) |
| InChIKey | ATGJWOVVAMFLEM-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|