C26H21Cl2NO2 — CID 24797739
3-[3-[5-(3,4-dichlorophenyl)-2-methyl-3-phenylpyrrol-1-yl]phenyl]propanoic acid (PubChem CID 24797739) has the molecular formula C26H21Cl2NO2 and a molecular weight of 450.37 g/mol. Its IUPAC name is 3-[3-[5-(3,4-dichlorophenyl)-2-methyl-3-phenylpyrrol-1-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-[5-(3,4-dichlorophenyl)-2-methyl-3-phenylpyrrol-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 24797739 |
| Molecular Formula | C26H21Cl2NO2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 3-[3-[5-(3,4-dichlorophenyl)-2-methyl-3-phenylpyrrol-1-yl]phenyl]propanoic acid |
| SMILES | Cc1c(-c2ccccc2)cc(-c2ccc(Cl)c(Cl)c2)n1-c1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C26H21Cl2NO2/c1-17-22(19-7-3-2-4-8-19)16-25(20-11-12-23(27)24(28)15-20)29(17)21-9-5-6-18(14-21)10-13-26(30)31/h2-9,11-12,14-16H,10,13H2,1H3,(H,30,31) |
| InChIKey | RNIVFNKMMIJFSB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|