C30H39NO — CID 143552960
4-[3-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]but-1-en-2-ol;ethane (PubChem CID 143552960) has the molecular formula C30H39NO and a molecular weight of 429.65 g/mol. Its IUPAC name is 4-[3-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]but-1-en-2-ol;ethane.
| Compound Name | 4-[3-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]but-1-en-2-ol;ethane |
|---|---|
| PubChem CID | 143552960 |
| Molecular Formula | C30H39NO |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 4-[3-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)phenyl]but-1-en-2-ol;ethane |
| SMILES | C=C(O)CCc1cccc(-n2c(-c3ccccc3)cc3c2CCC(C(C)(C)C)C3)c1.CC |
| InChI | InChI=1S/C28H33NO.C2H6/c1-20(30)13-14-21-9-8-12-25(17-21)29-26-16-15-24(28(2,3)4)18-23(26)19-27(29)22-10-6-5-7-11-22;1-2/h5-12,17,19,24,30H,1,13-16,18H2,2-4H3;1-2H3 |
| InChIKey | VSOBSRKGMSFPEK-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|