C29H27BrN2O — CID 22522043
N-[(2-bromophenyl)methyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 22522043) has the molecular formula C29H27BrN2O and a molecular weight of 499.45 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-[(2-bromophenyl)methyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 22522043 |
| Molecular Formula | C29H27BrN2O |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | CC1CCc2c(cc(-c3ccccc3)n2-c2ccc(C(=O)NCc3ccccc3Br)cc2)C1 |
| InChI | InChI=1S/C29H27BrN2O/c1-20-11-16-27-24(17-20)18-28(21-7-3-2-4-8-21)32(27)25-14-12-22(13-15-25)29(33)31-19-23-9-5-6-10-26(23)30/h2-10,12-15,18,20H,11,16-17,19H2,1H3,(H,31,33) |
| InChIKey | WCKCWGOZSLCZSJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|