C32H41N3O — CID 20908865
N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 20908865) has the molecular formula C32H41N3O and a molecular weight of 483.70 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 20908865 |
| Molecular Formula | C32H41N3O |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(=O)NCCCN3CCC(Cc4ccccc4)CC3)cc1)CCC(C)C2 |
| InChI | InChI=1S/C32H41N3O/c1-24-9-14-31-29(21-24)22-25(2)35(31)30-12-10-28(11-13-30)32(36)33-17-6-18-34-19-15-27(16-20-34)23-26-7-4-3-5-8-26/h3-5,7-8,10-13,22,24,27H,6,9,14-21,23H2,1-2H3,(H,33,36) |
| InChIKey | FUDVIELYVLEWEL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|