C26H30N2O — CID 20908852
4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)-N-(2-phenylpropyl)benzamide (PubChem CID 20908852) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is 4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)-N-(2-phenylpropyl)benzamide.
| Compound Name | 4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)-N-(2-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 20908852 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-(2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl)-N-(2-phenylpropyl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(=O)NCC(C)c3ccccc3)cc1)CCC(C)C2 |
| InChI | InChI=1S/C26H30N2O/c1-18-9-14-25-23(15-18)16-20(3)28(25)24-12-10-22(11-13-24)26(29)27-17-19(2)21-7-5-4-6-8-21/h4-8,10-13,16,18-19H,9,14-15,17H2,1-3H3,(H,27,29) |
| InChIKey | LSWNGBSJVMNJFU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|