C26H37N3O — CID 92689322
4-[(5R)-2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide (PubChem CID 92689322) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[(5R)-2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 4-[(5R)-2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 92689322 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 4-[(5R)-2,5-dimethyl-4,5,6,7-tetrahydroindol-1-yl]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(=O)NCCCN3CCCC[C@@H]3C)cc1)CC[C@@H](C)C2 |
| InChI | InChI=1S/C26H37N3O/c1-19-8-13-25-23(17-19)18-21(3)29(25)24-11-9-22(10-12-24)26(30)27-14-6-16-28-15-5-4-7-20(28)2/h9-12,18-20H,4-8,13-17H2,1-3H3,(H,27,30)/t19-,20+/m1/s1 |
| InChIKey | PLSRPPVQVLLGCZ-UXHICEINSA-N |
| XLogP | 4.90 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|