C28H33N3O — CID 22521987
4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 22521987) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 22521987 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCC1)c1ccc(-n2c(-c3ccccc3)cc3c2CCCC3)cc1 |
| InChI | InChI=1S/C28H33N3O/c32-28(29-17-8-20-30-18-6-7-19-30)23-13-15-25(16-14-23)31-26-12-5-4-11-24(26)21-27(31)22-9-2-1-3-10-22/h1-3,9-10,13-16,21H,4-8,11-12,17-20H2,(H,29,32) |
| InChIKey | OJGRSPZNEVNQDB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|