C29H28N2O — CID 20886155
N-[(4-methylphenyl)methyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 20886155) has the molecular formula C29H28N2O and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-[(4-methylphenyl)methyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 20886155 |
| Molecular Formula | C29H28N2O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(-n3c(-c4ccccc4)cc4c3CCCC4)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O/c1-21-11-13-22(14-12-21)20-30-29(32)24-15-17-26(18-16-24)31-27-10-6-5-9-25(27)19-28(31)23-7-3-2-4-8-23/h2-4,7-8,11-19H,5-6,9-10,20H2,1H3,(H,30,32) |
| InChIKey | PWPRXEVELOMETF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|