C32H31N3O — CID 22522083
N-[2-(1H-indol-3-yl)ethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide (PubChem CID 22522083) has the molecular formula C32H31N3O and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 22522083 |
| Molecular Formula | C32H31N3O |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1ccc(-n2c(-c3ccccc3)cc3c2CCCCC3)cc1 |
| InChI | InChI=1S/C32H31N3O/c36-32(33-20-19-26-22-34-29-13-8-7-12-28(26)29)24-15-17-27(18-16-24)35-30-14-6-2-5-11-25(30)21-31(35)23-9-3-1-4-10-23/h1,3-4,7-10,12-13,15-18,21-22,34H,2,5-6,11,14,19-20H2,(H,33,36) |
| InChIKey | YUJDVAOTOBQTGA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|