C25H27NO2 — CID 53212873
4-[2-(4-propan-2-ylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzoic acid (PubChem CID 53212873) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-[2-(4-propan-2-ylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-[2-(4-propan-2-ylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 53212873 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[2-(4-propan-2-ylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzoic acid |
| SMILES | CC(C)c1ccc(-c2cc3c(n2-c2ccc(C(=O)O)cc2)CCCCC3)cc1 |
| InChI | InChI=1S/C25H27NO2/c1-17(2)18-8-10-19(11-9-18)24-16-21-6-4-3-5-7-23(21)26(24)22-14-12-20(13-15-22)25(27)28/h8-17H,3-7H2,1-2H3,(H,27,28) |
| InChIKey | KRKIGGUQFIPZQC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|