C22H21NO3 — CID 53212875
4-[2-(3-methoxyphenyl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid (PubChem CID 53212875) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-[2-(3-methoxyphenyl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid.
| Compound Name | 4-[2-(3-methoxyphenyl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 53212875 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-[2-(3-methoxyphenyl)-4,5,6,7-tetrahydroindol-1-yl]benzoic acid |
| SMILES | COc1cccc(-c2cc3c(n2-c2ccc(C(=O)O)cc2)CCCC3)c1 |
| InChI | InChI=1S/C22H21NO3/c1-26-19-7-4-6-16(13-19)21-14-17-5-2-3-8-20(17)23(21)18-11-9-15(10-12-18)22(24)25/h4,6-7,9-14H,2-3,5,8H2,1H3,(H,24,25) |
| InChIKey | TXJXNSCMPOXAHY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|