C30H27NO3 — CID 143552989
3-[7-cyclobutyl-2-(3-methoxyphenyl)-4,5-dihydrobenzo[e]indol-3-yl]benzoic acid (PubChem CID 143552989) has the molecular formula C30H27NO3 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-[7-cyclobutyl-2-(3-methoxyphenyl)-4,5-dihydrobenzo[e]indol-3-yl]benzoic acid.
| Compound Name | 3-[7-cyclobutyl-2-(3-methoxyphenyl)-4,5-dihydrobenzo[e]indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 143552989 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-[7-cyclobutyl-2-(3-methoxyphenyl)-4,5-dihydrobenzo[e]indol-3-yl]benzoic acid |
| SMILES | COc1cccc(-c2cc3c(n2-c2cccc(C(=O)O)c2)CCc2cc(C4CCC4)ccc2-3)c1 |
| InChI | InChI=1S/C30H27NO3/c1-34-25-10-4-7-22(17-25)29-18-27-26-13-11-20(19-5-2-6-19)15-21(26)12-14-28(27)31(29)24-9-3-8-23(16-24)30(32)33/h3-4,7-11,13,15-19H,2,5-6,12,14H2,1H3,(H,32,33) |
| InChIKey | ZMXJUISIGGAMEO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|