C27H21NO3 — CID 59214606
3-[2-(4-methoxy-2-methylphenyl)benzo[e]indol-3-yl]benzoic acid (PubChem CID 59214606) has the molecular formula C27H21NO3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[2-(4-methoxy-2-methylphenyl)benzo[e]indol-3-yl]benzoic acid.
| Compound Name | 3-[2-(4-methoxy-2-methylphenyl)benzo[e]indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 59214606 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-[2-(4-methoxy-2-methylphenyl)benzo[e]indol-3-yl]benzoic acid |
| SMILES | COc1ccc(-c2cc3c4ccccc4ccc3n2-c2cccc(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C27H21NO3/c1-17-14-21(31-2)11-12-22(17)26-16-24-23-9-4-3-6-18(23)10-13-25(24)28(26)20-8-5-7-19(15-20)27(29)30/h3-16H,1-2H3,(H,29,30) |
| InChIKey | SJRRGAADFMZUGO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |