C30H33N3O3 — CID 46377299
N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-4-[2-(3-methoxyphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzamide (PubChem CID 46377299) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-4-[2-(3-methoxyphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzamide.
| Compound Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-4-[2-(3-methoxyphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 46377299 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-4-[2-(3-methoxyphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl]benzamide |
| SMILES | COc1cccc(-c2cc3c(n2-c2ccc(C(=O)NCCc4c(C)noc4C)cc2)CCCCC3)c1 |
| InChI | InChI=1S/C30H33N3O3/c1-20-27(21(2)36-32-20)16-17-31-30(34)22-12-14-25(15-13-22)33-28-11-6-4-5-8-24(28)19-29(33)23-9-7-10-26(18-23)35-3/h7,9-10,12-15,18-19H,4-6,8,11,16-17H2,1-3H3,(H,31,34) |
| InChIKey | LEOARFYYMQZAOQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|