C32H34N2O3 — CID 22522018
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 22522018) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 22522018 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(-n3c(-c4ccccc4)cc4c3CCC(C)C4)cc2)cc1OC |
| InChI | InChI=1S/C32H34N2O3/c1-22-9-15-28-26(19-22)21-29(24-7-5-4-6-8-24)34(28)27-13-11-25(12-14-27)32(35)33-18-17-23-10-16-30(36-2)31(20-23)37-3/h4-8,10-14,16,20-22H,9,15,17-19H2,1-3H3,(H,33,35) |
| InChIKey | TXIGROQSXDHQMY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|