C29H27FN2O — CID 22522080
N-[(4-fluorophenyl)methyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide (PubChem CID 22522080) has the molecular formula C29H27FN2O and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 22522080 |
| Molecular Formula | C29H27FN2O |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(-n2c(-c3ccccc3)cc3c2CCCCC3)cc1 |
| InChI | InChI=1S/C29H27FN2O/c30-25-15-11-21(12-16-25)20-31-29(33)23-13-17-26(18-14-23)32-27-10-6-2-5-9-24(27)19-28(32)22-7-3-1-4-8-22/h1,3-4,7-8,11-19H,2,5-6,9-10,20H2,(H,31,33) |
| InChIKey | UACNYWXHFHMCHH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|