C30H30N2O — CID 92703985
N-[(1S)-1-phenylethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide (PubChem CID 92703985) has the molecular formula C30H30N2O and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide.
| Compound Name | N-[(1S)-1-phenylethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 92703985 |
| Molecular Formula | C30H30N2O |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(-n2c(-c3ccccc3)cc3c2CCCCC3)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O/c1-22(23-11-5-2-6-12-23)31-30(33)25-17-19-27(20-18-25)32-28-16-10-4-9-15-26(28)21-29(32)24-13-7-3-8-14-24/h2-3,5-8,11-14,17-22H,4,9-10,15-16H2,1H3,(H,31,33)/t22-/m0/s1 |
| InChIKey | WUPXLSGYZOMEFU-QFIPXVFZSA-N |
| XLogP | 6.90 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|