C30H39N3O — CID 22521989
N-[3-(dipropylamino)propyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 22521989) has the molecular formula C30H39N3O and a molecular weight of 457.66 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-[3-(dipropylamino)propyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 22521989 |
| Molecular Formula | C30H39N3O |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-4-(2-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | CCCN(CCC)CCCNC(=O)c1ccc(-n2c(-c3ccccc3)cc3c2CCCC3)cc1 |
| InChI | InChI=1S/C30H39N3O/c1-3-20-32(21-4-2)22-10-19-31-30(34)25-15-17-27(18-16-25)33-28-14-9-8-13-26(28)23-29(33)24-11-6-5-7-12-24/h5-7,11-12,15-18,23H,3-4,8-10,13-14,19-22H2,1-2H3,(H,31,34) |
| InChIKey | CTDYPAHSVMLEOY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|