C26H37N3O — CID 20908824
N-[3-[cyclohexyl(methyl)amino]propyl]-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 20908824) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 20908824 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(=O)NCCCN(C)C3CCCCC3)cc1)CCCC2 |
| InChI | InChI=1S/C26H37N3O/c1-20-19-22-9-6-7-12-25(22)29(20)24-15-13-21(14-16-24)26(30)27-17-8-18-28(2)23-10-4-3-5-11-23/h13-16,19,23H,3-12,17-18H2,1-2H3,(H,27,30) |
| InChIKey | QGZCJETYPKJRDM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|