C24H32N2O — CID 20908802
N-(2,3-dimethylcyclohexyl)-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide (PubChem CID 20908802) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 20908802 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-4-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(=O)NC3CCCC(C)C3C)cc1)CCCC2 |
| InChI | InChI=1S/C24H32N2O/c1-16-7-6-9-22(18(16)3)25-24(27)19-11-13-21(14-12-19)26-17(2)15-20-8-4-5-10-23(20)26/h11-16,18,22H,4-10H2,1-3H3,(H,25,27) |
| InChIKey | WIUWKDAZEUIOSH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|