C29H26N2O — CID 101119237
N-benzyl-4-[5-(4-methylphenyl)-1,3-dihydroisoindol-2-yl]benzamide (PubChem CID 101119237) has the molecular formula C29H26N2O and a molecular weight of 418.54 g/mol. Its IUPAC name is N-benzyl-4-[5-(4-methylphenyl)-1,3-dihydroisoindol-2-yl]benzamide.
| Compound Name | N-benzyl-4-[5-(4-methylphenyl)-1,3-dihydroisoindol-2-yl]benzamide |
|---|---|
| PubChem CID | 101119237 |
| Molecular Formula | C29H26N2O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-benzyl-4-[5-(4-methylphenyl)-1,3-dihydroisoindol-2-yl]benzamide |
| SMILES | Cc1ccc(-c2ccc3c(c2)CN(c2ccc(C(=O)NCc4ccccc4)cc2)C3)cc1 |
| InChI | InChI=1S/C29H26N2O/c1-21-7-9-23(10-8-21)25-11-12-26-19-31(20-27(26)17-25)28-15-13-24(14-16-28)29(32)30-18-22-5-3-2-4-6-22/h2-17H,18-20H2,1H3,(H,30,32) |
| InChIKey | XBANESKQOPEHOP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |