C20H28N4O — CID 35417488
N-[3-(4-methylpiperidin-1-yl)propyl]-4-(5-methylpyrazol-1-yl)benzamide (PubChem CID 35417488) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-4-(5-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-4-(5-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 35417488 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-4-(5-methylpyrazol-1-yl)benzamide |
| SMILES | Cc1ccnn1-c1ccc(C(=O)NCCCN2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O/c1-16-9-14-23(15-10-16)13-3-11-21-20(25)18-4-6-19(7-5-18)24-17(2)8-12-22-24/h4-8,12,16H,3,9-11,13-15H2,1-2H3,(H,21,25) |
| InChIKey | IPLONGAHTCWDBG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|