C22H31ClN4O — CID 55716610
4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]benzamide (PubChem CID 55716610) has the molecular formula C22H31ClN4O and a molecular weight of 402.97 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]benzamide.
| Compound Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55716610 |
| Molecular Formula | C22H31ClN4O |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]benzamide |
| SMILES | Cc1nn(-c2ccc(C(=O)NCCCCN3CCC(C)CC3)cc2)c(C)c1Cl |
| InChI | InChI=1S/C22H31ClN4O/c1-16-10-14-26(15-11-16)13-5-4-12-24-22(28)19-6-8-20(9-7-19)27-18(3)21(23)17(2)25-27/h6-9,16H,4-5,10-15H2,1-3H3,(H,24,28) |
| InChIKey | UAGSRVGOJDUDNW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|