C28H32N2O — CID 46272451
(4-methylpiperidin-1-yl)-[4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)phenyl]methanone (PubChem CID 46272451) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)phenyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 46272451 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[4-(2-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]pyrrol-1-yl)phenyl]methanone |
| SMILES | CC1CCN(C(=O)c2ccc(-n3c(-c4ccccc4)cc4c3CCCCC4)cc2)CC1 |
| InChI | InChI=1S/C28H32N2O/c1-21-16-18-29(19-17-21)28(31)23-12-14-25(15-13-23)30-26-11-7-3-6-10-24(26)20-27(30)22-8-4-2-5-9-22/h2,4-5,8-9,12-15,20-21H,3,6-7,10-11,16-19H2,1H3 |
| InChIKey | XVCXTBUHGYKWOV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|