C30H40N2O — CID 143552951
3-[5-(2,3-dimethylbutan-2-yl)-2-phenyl-4,5,6,7-tetrahydroindol-1-yl]-N-methylbenzamide;ethane (PubChem CID 143552951) has the molecular formula C30H40N2O and a molecular weight of 444.66 g/mol. Its IUPAC name is 3-[5-(2,3-dimethylbutan-2-yl)-2-phenyl-4,5,6,7-tetrahydroindol-1-yl]-N-methylbenzamide;ethane.
| Compound Name | 3-[5-(2,3-dimethylbutan-2-yl)-2-phenyl-4,5,6,7-tetrahydroindol-1-yl]-N-methylbenzamide;ethane |
|---|---|
| PubChem CID | 143552951 |
| Molecular Formula | C30H40N2O |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 3-[5-(2,3-dimethylbutan-2-yl)-2-phenyl-4,5,6,7-tetrahydroindol-1-yl]-N-methylbenzamide;ethane |
| SMILES | CC.CNC(=O)c1cccc(-n2c(-c3ccccc3)cc3c2CCC(C(C)(C)C(C)C)C3)c1 |
| InChI | InChI=1S/C28H34N2O.C2H6/c1-19(2)28(3,4)23-14-15-25-22(16-23)18-26(20-10-7-6-8-11-20)30(25)24-13-9-12-21(17-24)27(31)29-5;1-2/h6-13,17-19,23H,14-16H2,1-5H3,(H,29,31);1-2H3 |
| InChIKey | GFRDZQOPJLTSSZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|