C27H32ClNO2 — CID 143214756
5-(5-butan-2-yl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-chlorobenzoic acid;ethane (PubChem CID 143214756) has the molecular formula C27H32ClNO2 and a molecular weight of 438.01 g/mol. Its IUPAC name is 5-(5-butan-2-yl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-chlorobenzoic acid;ethane.
| Compound Name | 5-(5-butan-2-yl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-chlorobenzoic acid;ethane |
|---|---|
| PubChem CID | 143214756 |
| Molecular Formula | C27H32ClNO2 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 5-(5-butan-2-yl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-chlorobenzoic acid;ethane |
| SMILES | CC.CCC(C)C1CCc2c(cc(-c3ccccc3)n2-c2ccc(Cl)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C25H26ClNO2.C2H6/c1-3-16(2)18-9-12-23-19(13-18)14-24(17-7-5-4-6-8-17)27(23)20-10-11-22(26)21(15-20)25(28)29;1-2/h4-8,10-11,14-16,18H,3,9,12-13H2,1-2H3,(H,28,29);1-2H3 |
| InChIKey | ILTHNCXQEZOKQM-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|