C37H31IrN5-2 — CID 169309459
CID 169309459 (PubChem CID 169309459) has the molecular formula C37H31IrN5-2 and a molecular weight of 737.91 g/mol.
| Compound Name | CID 169309459 |
|---|---|
| PubChem CID | 169309459 |
| Molecular Formula | C37H31IrN5-2 |
| Molecular Weight | 737.91 g/mol |
| Exact Mass | 738.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c(c1)n1c3ccccc3nc1n1c3[c-]cccc3nc21.Cc1c[c-]c(-c2ccc(C)cn2)cc1.[Ir] |
| InChI | InChI=1S/C24H19N4.C13H12N.Ir/c1-24(2,3)15-12-13-16-21(14-15)27-19-10-6-5-9-18(19)26-23(27)28-20-11-7-4-8-17(20)25-22(16)28;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-10,12-14H,1-3H3;3-6,8-9H,1-2H3;/q2*-1; |
| InChIKey | ASSZKRSOOGQYSU-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 47.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.91 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|