About CID 169309312
CID 169309312 (PubChem CID 169309312) has the molecular formula C34H23IrN7-2
and a molecular weight of 721.82 g/mol.
Molecular Properties
| Compound Name | CID 169309312 |
| PubChem CID | 169309312 |
| Molecular Formula | C34H23IrN7-2 |
| Molecular Weight | 721.82 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | — |
| SMILES | Cc1c[c-]c(-c2ccc(C)cn2)cc1.[Ir].[c-]1cccc2nc3n(c12)c1nc2ccccc2n1c1nc2ccccc2n31 |
| InChI | InChI=1S/C21H11N6.C13H12N.Ir/c1-4-10-16-13(7-1)22-19-25(16)20-23-15-9-3-6-12-18(15)27(20)21-24-14-8-2-5-11-17(14)26(19)21;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h1-11H;3-6,8-9H,1-2H3;/q2*-1; |
| InChIKey | PNJNEHUDOCUNAB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 64.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 721.82 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 169309312 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169309312?
The IUPAC name of CID 169309312 (CID 169309312) is not available.
What is the SMILES notation for CID 169309312?
The canonical SMILES for CID 169309312 is Cc1c[c-]c(-c2ccc(C)cn2)cc1.[Ir].[c-]1cccc2nc3n(c12)c1nc2ccccc2n1c1nc2ccccc2n31.
What is the InChIKey of CID 169309312?
The InChIKey is PNJNEHUDOCUNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11N6.C13H12N.Ir/c1-4-10-16-13(7-1)22-19-25(16)20-23-15-9-3-6-12-18(15)27(20)21-24-14-8-2-5-11-17(14)26(19)21;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h1-11H;3-6,8-9H,1-2H3;/q2*-1;.
What are the key properties of CID 169309312?
CID 169309312 has a molecular weight of 721.82 g/mol, XLogP of 7.05, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169309312 is sourced from PubChem (CID 169309312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).