C35H30IrN4-2 — CID 164805417
CID 164805417 (PubChem CID 164805417) has the molecular formula C35H30IrN4-2 and a molecular weight of 703.90 g/mol.
| Compound Name | CID 164805417 |
|---|---|
| PubChem CID | 164805417 |
| Molecular Formula | C35H30IrN4-2 |
| Molecular Weight | 703.90 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])(c1ccnc2c3[c-]cccc3n3c4ccccc4nc3c12)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C23H20N3.C12H10N.Ir/c1-23(2,3)14-15-12-13-24-21-16-8-4-6-10-18(16)26-19-11-7-5-9-17(19)25-22(26)20(15)21;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h4-7,9-13H,14H2,1-3H3;2-5,7-9H,1H3;/q2*-1;/i14D2;1D3; |
| InChIKey | WKJZLRFUBLOXTD-CFVCGBMHSA-N |
| XLogP | 8.43 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.90 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|