C35H28IrN2S-2 — CID 162454725
CID 162454725 (PubChem CID 162454725) has the molecular formula C35H28IrN2S-2 and a molecular weight of 702.92 g/mol.
| Compound Name | CID 162454725 |
|---|---|
| PubChem CID | 162454725 |
| Molecular Formula | C35H28IrN2S-2 |
| Molecular Weight | 702.92 g/mol |
| Exact Mass | 703.17 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccnc2c3[c-]cccc3c3cc4ccsc4cc3c12)C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C24H20NS.C11H8N.Ir/c1-24(2,3)14-16-8-10-25-23-18-7-5-4-6-17(18)19-12-15-9-11-26-21(15)13-20(19)22(16)23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-6,8-13H,14H2,1-3H3;1-6,8-9H;/q2*-1;/i14D2;; |
| InChIKey | RESQMIRBMCXYET-YYXRFDLRSA-N |
| XLogP | 9.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.92 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|