C44H34IrN2O-2 — CID 162454706
CID 162454706 (PubChem CID 162454706) has the molecular formula C44H34IrN2O-2 and a molecular weight of 804.02 g/mol.
| Compound Name | CID 162454706 |
|---|---|
| PubChem CID | 162454706 |
| Molecular Formula | C44H34IrN2O-2 |
| Molecular Weight | 804.02 g/mol |
| Exact Mass | 804.26 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc2c3[c-]cccc3c3ccc4c5cc6ccccc6cc5oc4c3c2c1C([2H])([2H])C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C33H26NO.C11H8N.Ir/c1-19-18-34-31-24-12-8-7-11-22(24)23-13-14-25-26-15-20-9-5-6-10-21(20)16-28(26)35-32(25)30(23)29(31)27(19)17-33(2,3)4;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-11,13-16,18H,17H2,1-4H3;1-6,8-9H;/q2*-1;/i1D3,17D2;; |
| InChIKey | IYDOIDSHMYRGCL-SWTWTNFSSA-N |
| XLogP | 11.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.02 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|