C40H32IrN2S-2 — CID 162454678
CID 162454678 (PubChem CID 162454678) has the molecular formula C40H32IrN2S-2 and a molecular weight of 770.02 g/mol.
| Compound Name | CID 162454678 |
|---|---|
| PubChem CID | 162454678 |
| Molecular Formula | C40H32IrN2S-2 |
| Molecular Weight | 770.02 g/mol |
| Exact Mass | 770.22 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc2c3[c-]cccc3c3ccc4c5ccccc5sc4c3c2c1C([2H])([2H])C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C29H24NS.C11H8N.Ir/c1-17-16-30-27-21-11-6-5-9-18(21)20-13-14-22-19-10-7-8-12-24(19)31-28(22)26(20)25(27)23(17)15-29(2,3)4;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-10,12-14,16H,15H2,1-4H3;1-6,8-9H;/q2*-1;/i1D3,15D2;; |
| InChIKey | QFUATNMAUYZZRL-BKZADQPCSA-N |
| XLogP | 11.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.02 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|