C40H30IrN2S-2 — CID 167354972
6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]quinoline;iridium;2-phenylpyridine (PubChem CID 167354972) has the molecular formula C40H30IrN2S-2 and a molecular weight of 762.98 g/mol. Its IUPAC name is 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]quinoline;iridium;2-phenylpyridine.
| Compound Name | 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]quinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 167354972 |
| Molecular Formula | C40H30IrN2S-2 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 763.18 |
| IUPAC Name | 6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]quinoline;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1cc(-c2nc3ccccc3c3sc4ccccc4c23)[c-]c2ccccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C29H22NS.C11H8N.Ir/c1-29(2,3)23-17-19(16-18-10-4-5-11-20(18)23)27-26-22-13-7-9-15-25(22)31-28(26)21-12-6-8-14-24(21)30-27;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-15,17H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | TVRXQONOOPLSHJ-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|