C30H21N2Pt-3 — CID 171732600
2-(4-methylbenzene-6-id-1-yl)pyridine;9-phenyl-1H-carbazol-1-ide;platinum (PubChem CID 171732600) has the molecular formula C30H21N2Pt-3 and a molecular weight of 604.59 g/mol. Its IUPAC name is 2-(4-methylbenzene-6-id-1-yl)pyridine;9-phenyl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-(4-methylbenzene-6-id-1-yl)pyridine;9-phenyl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 171732600 |
| Molecular Formula | C30H21N2Pt-3 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | 2-(4-methylbenzene-6-id-1-yl)pyridine;9-phenyl-1H-carbazol-1-ide;platinum |
| SMILES | Cc1c[c-]c(-c2ccccn2)cc1.[Pt].[c-]1ccccc1-n1c2[c-]cccc2c2ccccc21 |
| InChI | InChI=1S/C18H11N.C12H10N.Pt/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-10-5-7-11(8-6-10)12-4-2-3-9-13-12;/h1-8,10-12H;2-7,9H,1H3;/q-2;-1; |
| InChIKey | RBBDKODXUPGJCM-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|