C31H22IrN2-2 — CID 59470354
iridium;2-(4-methylbenzene-6-id-1-yl)pyridine;2-phenylbenzo[f]isoquinoline (PubChem CID 59470354) has the molecular formula C31H22IrN2-2 and a molecular weight of 614.75 g/mol. Its IUPAC name is iridium;2-(4-methylbenzene-6-id-1-yl)pyridine;2-phenylbenzo[f]isoquinoline.
| Compound Name | iridium;2-(4-methylbenzene-6-id-1-yl)pyridine;2-phenylbenzo[f]isoquinoline |
|---|---|
| PubChem CID | 59470354 |
| Molecular Formula | C31H22IrN2-2 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | iridium;2-(4-methylbenzene-6-id-1-yl)pyridine;2-phenylbenzo[f]isoquinoline |
| SMILES | Cc1c[c-]c(-c2ccccn2)cc1.[Ir].[c-]1ccccc1-c1cc2c(ccc3ccccc32)cn1 |
| InChI | InChI=1S/C19H12N.C12H10N.Ir/c1-2-7-15(8-3-1)19-12-18-16(13-20-19)11-10-14-6-4-5-9-17(14)18;1-10-5-7-11(8-6-10)12-4-2-3-9-13-12;/h1-7,9-13H;2-7,9H,1H3;/q2*-1; |
| InChIKey | AAUUMZJBTDSBIU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|