C44H32IrN2-2 — CID 172506624
iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine (PubChem CID 172506624) has the molecular formula C44H32IrN2-2 and a molecular weight of 780.97 g/mol. Its IUPAC name is iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine.
| Compound Name | iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 172506624 |
| Molecular Formula | C44H32IrN2-2 |
| Molecular Weight | 780.97 g/mol |
| Exact Mass | 781.22 |
| IUPAC Name | iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine |
| SMILES | Cc1c[c-]c(-c2cc(-c3ccccc3)c(C)cn2)cc1.[Ir].[c-]1ccc(-c2cc3ccccc3c3ccccc23)cc1-c1ccccn1 |
| InChI | InChI=1S/C25H16N.C19H16N.Ir/c1-2-11-21-19(8-1)17-24(23-13-4-3-12-22(21)23)18-9-7-10-20(16-18)25-14-5-6-15-26-25;1-14-8-10-17(11-9-14)19-12-18(15(2)13-20-19)16-6-4-3-5-7-16;/h1-9,11-17H;3-10,12-13H,1-2H3;/q2*-1; |
| InChIKey | ANGJKJVSBJKVGF-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.97 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|