C36H29IrN3-2 — CID 140847547
iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyrimidine (PubChem CID 140847547) has the molecular formula C36H29IrN3-2 and a molecular weight of 695.87 g/mol. Its IUPAC name is iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyrimidine.
| Compound Name | iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyrimidine |
|---|---|
| PubChem CID | 140847547 |
| Molecular Formula | C36H29IrN3-2 |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine;4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyrimidine |
| SMILES | Cc1c[c-]c(-c2cc(-c3ccccc3)c(C)cn2)cc1.Cc1ccnc(-c2[c-]ccc(-c3ccccc3)c2)n1.[Ir] |
| InChI | InChI=1S/C19H16N.C17H13N2.Ir/c1-14-8-10-17(11-9-14)19-12-18(15(2)13-20-19)16-6-4-3-5-7-16;1-13-10-11-18-17(19-13)16-9-5-8-15(12-16)14-6-3-2-4-7-14;/h3-10,12-13H,1-2H3;2-8,10-12H,1H3;/q2*-1; |
| InChIKey | UKSXIOBDTFQXIC-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|