C50H44IrN2-2 — CID 172506655
4-(2,2-dimethylpropyl)-5-methyl-2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine (PubChem CID 172506655) has the molecular formula C50H44IrN2-2 and a molecular weight of 865.13 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-5-methyl-2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine.
| Compound Name | 4-(2,2-dimethylpropyl)-5-methyl-2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine |
|---|---|
| PubChem CID | 172506655 |
| Molecular Formula | C50H44IrN2-2 |
| Molecular Weight | 865.13 g/mol |
| Exact Mass | 865.31 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-5-methyl-2-(3-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;5-methyl-2-(4-methylbenzene-6-id-1-yl)-4-phenylpyridine |
| SMILES | Cc1c[c-]c(-c2cc(-c3ccccc3)c(C)cn2)cc1.Cc1cnc(-c2[c-]ccc(-c3cc4ccccc4c4ccccc34)c2)cc1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H28N.C19H16N.Ir/c1-21-20-32-30(18-25(21)19-31(2,3)4)24-12-9-11-22(16-24)29-17-23-10-5-6-13-26(23)27-14-7-8-15-28(27)29;1-14-8-10-17(11-9-14)19-12-18(15(2)13-20-19)16-6-4-3-5-7-16;/h5-11,13-18,20H,19H2,1-4H3;3-10,12-13H,1-2H3;/q2*-1; |
| InChIKey | FHPWPWLZERQEMU-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.13 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|